C9H21BNO6- — CID 71295765
[(5R)-5-amino-5-carboxy-8-hydroxyoctyl]-trihydroxyboranuide (PubChem CID 71295765) has the molecular formula C9H21BNO6- and a molecular weight of 250.08 g/mol. Its IUPAC name is [(5R)-5-amino-5-carboxy-8-hydroxyoctyl]-trihydroxyboranuide.
| Compound Name | [(5R)-5-amino-5-carboxy-8-hydroxyoctyl]-trihydroxyboranuide |
|---|---|
| PubChem CID | 71295765 |
| Molecular Formula | C9H21BNO6- |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | [(5R)-5-amino-5-carboxy-8-hydroxyoctyl]-trihydroxyboranuide |
| SMILES | N[C@@](CCCO)(CCCC[B-](O)(O)O)C(=O)O |
| InChI | InChI=1S/C9H21BNO6/c11-9(8(13)14,5-3-7-12)4-1-2-6-10(15,16)17/h12,15-17H,1-7,11H2,(H,13,14)/q-1/t9-/m1/s1 |
| InChIKey | NLSMSWJRKXBPCL-SECBINFHSA-N |
| XLogP | -1.37 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|