C20H31BN2O2 — CID 88582628
CID 88582628 (PubChem CID 88582628) has the molecular formula C20H31BN2O2 and a molecular weight of 342.29 g/mol.
| Compound Name | CID 88582628 |
|---|---|
| PubChem CID | 88582628 |
| Molecular Formula | C20H31BN2O2 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | — |
| SMILES | [B]CCCCC(N)(CCN1CCC(Cc2ccccc2)CC1)C(=O)O |
| InChI | InChI=1S/C20H31BN2O2/c21-12-5-4-10-20(22,19(24)25)11-15-23-13-8-18(9-14-23)16-17-6-2-1-3-7-17/h1-3,6-7,18H,4-5,8-16,22H2,(H,24,25) |
| InChIKey | WUYGVCGMJXDZMO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|