C21H32BCl2N3O4 — CID 66833338
2-amino-6-borono-2-[1-(quinolin-8-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride (PubChem CID 66833338) has the molecular formula C21H32BCl2N3O4 and a molecular weight of 472.22 g/mol. Its IUPAC name is 2-amino-6-borono-2-[1-(quinolin-8-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride.
| Compound Name | 2-amino-6-borono-2-[1-(quinolin-8-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 66833338 |
| Molecular Formula | C21H32BCl2N3O4 |
| Molecular Weight | 472.22 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-amino-6-borono-2-[1-(quinolin-8-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NC(CCCCB(O)O)(C(=O)O)C1CCN(Cc2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C21H30BN3O4.2ClH/c23-21(20(26)27,10-1-2-11-22(28)29)18-8-13-25(14-9-18)15-17-6-3-5-16-7-4-12-24-19(16)17;;/h3-7,12,18,28-29H,1-2,8-11,13-15,23H2,(H,26,27);2*1H |
| InChIKey | GNKXFHQPTMLLSX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|