C25H37BCl2N2O5 — CID 66833657
2-amino-6-borono-2-[1-[[2-(3-methoxyphenyl)phenyl]methyl]piperidin-4-yl]hexanoic acid;dihydrochloride (PubChem CID 66833657) has the molecular formula C25H37BCl2N2O5 and a molecular weight of 527.30 g/mol. Its IUPAC name is 2-amino-6-borono-2-[1-[[2-(3-methoxyphenyl)phenyl]methyl]piperidin-4-yl]hexanoic acid;dihydrochloride.
| Compound Name | 2-amino-6-borono-2-[1-[[2-(3-methoxyphenyl)phenyl]methyl]piperidin-4-yl]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 66833657 |
| Molecular Formula | C25H37BCl2N2O5 |
| Molecular Weight | 527.30 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 2-amino-6-borono-2-[1-[[2-(3-methoxyphenyl)phenyl]methyl]piperidin-4-yl]hexanoic acid;dihydrochloride |
| SMILES | COc1cccc(-c2ccccc2CN2CCC(C(N)(CCCCB(O)O)C(=O)O)CC2)c1.Cl.Cl |
| InChI | InChI=1S/C25H35BN2O5.2ClH/c1-33-22-9-6-8-19(17-22)23-10-3-2-7-20(23)18-28-15-11-21(12-16-28)25(27,24(29)30)13-4-5-14-26(31)32;;/h2-3,6-10,17,21,31-32H,4-5,11-16,18,27H2,1H3,(H,29,30);2*1H |
| InChIKey | RIQIEKKOAHUJSF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|