C21H28BNO5 — CID 46850231
2-amino-6-borono-2-[3-(3-phenylphenoxy)propyl]hexanoic acid (PubChem CID 46850231) has the molecular formula C21H28BNO5 and a molecular weight of 385.27 g/mol. Its IUPAC name is 2-amino-6-borono-2-[3-(3-phenylphenoxy)propyl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[3-(3-phenylphenoxy)propyl]hexanoic acid |
|---|---|
| PubChem CID | 46850231 |
| Molecular Formula | C21H28BNO5 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 2-amino-6-borono-2-[3-(3-phenylphenoxy)propyl]hexanoic acid |
| SMILES | NC(CCCCB(O)O)(CCCOc1cccc(-c2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C21H28BNO5/c23-21(20(24)25,12-4-5-14-22(26)27)13-7-15-28-19-11-6-10-18(16-19)17-8-2-1-3-9-17/h1-3,6,8-11,16,26-27H,4-5,7,12-15,23H2,(H,24,25) |
| InChIKey | RVRRTMKBDMXTKM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|