C14H21BN2O7 — CID 46849887
2-amino-6-borono-2-[2-(3-nitrophenoxy)ethyl]hexanoic acid (PubChem CID 46849887) has the molecular formula C14H21BN2O7 and a molecular weight of 340.14 g/mol. Its IUPAC name is 2-amino-6-borono-2-[2-(3-nitrophenoxy)ethyl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[2-(3-nitrophenoxy)ethyl]hexanoic acid |
|---|---|
| PubChem CID | 46849887 |
| Molecular Formula | C14H21BN2O7 |
| Molecular Weight | 340.14 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-amino-6-borono-2-[2-(3-nitrophenoxy)ethyl]hexanoic acid |
| SMILES | NC(CCCCB(O)O)(CCOc1cccc([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C14H21BN2O7/c16-14(13(18)19,6-1-2-8-15(20)21)7-9-24-12-5-3-4-11(10-12)17(22)23/h3-5,10,20-21H,1-2,6-9,16H2,(H,18,19) |
| InChIKey | DGPBACWVFHBCDY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.14 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|