C15H22BClF3NO5 — CID 66832770
2-amino-6-borono-2-[2-[3-(trifluoromethyl)phenoxy]ethyl]hexanoic acid;hydrochloride (PubChem CID 66832770) has the molecular formula C15H22BClF3NO5 and a molecular weight of 399.60 g/mol. Its IUPAC name is 2-amino-6-borono-2-[2-[3-(trifluoromethyl)phenoxy]ethyl]hexanoic acid;hydrochloride.
| Compound Name | 2-amino-6-borono-2-[2-[3-(trifluoromethyl)phenoxy]ethyl]hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 66832770 |
| Molecular Formula | C15H22BClF3NO5 |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 2-amino-6-borono-2-[2-[3-(trifluoromethyl)phenoxy]ethyl]hexanoic acid;hydrochloride |
| SMILES | Cl.NC(CCCCB(O)O)(CCOc1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C15H21BF3NO5.ClH/c17-15(18,19)11-4-3-5-12(10-11)25-9-7-14(20,13(21)22)6-1-2-8-16(23)24;/h3-5,10,23-24H,1-2,6-9,20H2,(H,21,22);1H |
| InChIKey | GWCDZCXHBDPOGA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|