C18H24BF3N2O2 — CID 147454584
CID 147454584 (PubChem CID 147454584) has the molecular formula C18H24BF3N2O2 and a molecular weight of 368.21 g/mol.
| Compound Name | CID 147454584 |
|---|---|
| PubChem CID | 147454584 |
| Molecular Formula | C18H24BF3N2O2 |
| Molecular Weight | 368.21 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | — |
| SMILES | [B]CCCCC(N)(C(=O)O)[C@@H]1CCN(Cc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C18H24BF3N2O2/c19-9-2-1-8-17(23,16(25)26)15-7-10-24(12-15)11-13-3-5-14(6-4-13)18(20,21)22/h3-6,15H,1-2,7-12,23H2,(H,25,26)/t15-,17?/m1/s1 |
| InChIKey | GOUYFDSSFZGDFH-LDCVWXEPSA-N |
| XLogP | 3.07 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.21 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|