C19H30BClF3N3O6S — CID 140831266
2-amino-6-borono-2-[1-[[4-(trifluoromethyl)phenyl]methylsulfamoyl]piperidin-4-yl]hexanoic acid;hydrochloride (PubChem CID 140831266) has the molecular formula C19H30BClF3N3O6S and a molecular weight of 531.79 g/mol. Its IUPAC name is 2-amino-6-borono-2-[1-[[4-(trifluoromethyl)phenyl]methylsulfamoyl]piperidin-4-yl]hexanoic acid;hydrochloride.
| Compound Name | 2-amino-6-borono-2-[1-[[4-(trifluoromethyl)phenyl]methylsulfamoyl]piperidin-4-yl]hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 140831266 |
| Molecular Formula | C19H30BClF3N3O6S |
| Molecular Weight | 531.79 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 2-amino-6-borono-2-[1-[[4-(trifluoromethyl)phenyl]methylsulfamoyl]piperidin-4-yl]hexanoic acid;hydrochloride |
| SMILES | Cl.NC(CCCCB(O)O)(C(=O)O)C1CCN(S(=O)(=O)NCc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H29BF3N3O6S.ClH/c21-19(22,23)16-5-3-14(4-6-16)13-25-33(31,32)26-11-7-15(8-12-26)18(24,17(27)28)9-1-2-10-20(29)30;/h3-6,15,25,29-30H,1-2,7-13,24H2,(H,27,28);1H |
| InChIKey | IGECZQJVZDCOFW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.79 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|