C22H32BF3N2O3 — CID 163673860
[(5R)-5-amino-6-oxo-5-[1-[6-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]piperidin-4-yl]heptyl]boronic acid (PubChem CID 163673860) has the molecular formula C22H32BF3N2O3 and a molecular weight of 440.32 g/mol. Its IUPAC name is [(5R)-5-amino-6-oxo-5-[1-[6-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]piperidin-4-yl]heptyl]boronic acid.
| Compound Name | [(5R)-5-amino-6-oxo-5-[1-[6-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]piperidin-4-yl]heptyl]boronic acid |
|---|---|
| PubChem CID | 163673860 |
| Molecular Formula | C22H32BF3N2O3 |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | [(5R)-5-amino-6-oxo-5-[1-[6-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]piperidin-4-yl]heptyl]boronic acid |
| SMILES | CC(=O)[C@@](N)(CCCCB(O)O)C1CCN(C2CCc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C22H32BF3N2O3/c1-15(29)21(27,10-2-3-11-23(30)31)17-8-12-28(13-9-17)20-7-5-16-4-6-18(14-19(16)20)22(24,25)26/h4,6,14,17,20,30-31H,2-3,5,7-13,27H2,1H3/t20?,21-/m0/s1 |
| InChIKey | LNFSTAXDIVNDFW-LBAQZLPGSA-N |
| XLogP | 3.33 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|