C17H25BClN3O4S — CID 87173179
2-amino-6-borono-2-[1-[(4-chlorophenyl)carbamothioyl]pyrrolidin-3-yl]hexanoic acid (PubChem CID 87173179) has the molecular formula C17H25BClN3O4S and a molecular weight of 413.74 g/mol. Its IUPAC name is 2-amino-6-borono-2-[1-[(4-chlorophenyl)carbamothioyl]pyrrolidin-3-yl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[1-[(4-chlorophenyl)carbamothioyl]pyrrolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 87173179 |
| Molecular Formula | C17H25BClN3O4S |
| Molecular Weight | 413.74 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-amino-6-borono-2-[1-[(4-chlorophenyl)carbamothioyl]pyrrolidin-3-yl]hexanoic acid |
| SMILES | NC(CCCCB(O)O)(C(=O)O)C1CCN(C(=S)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H25BClN3O4S/c19-13-3-5-14(6-4-13)21-16(27)22-10-7-12(11-22)17(20,15(23)24)8-1-2-9-18(25)26/h3-6,12,25-26H,1-2,7-11,20H2,(H,21,27)(H,23,24) |
| InChIKey | FDBZZYSMZMCVDC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.74 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|