C19H26ClN3OS — CID 121238333
3-(1-acetylpiperidin-2-yl)-N-(4-chlorophenyl)piperidine-1-carbothioamide (PubChem CID 121238333) has the molecular formula C19H26ClN3OS and a molecular weight of 379.96 g/mol. Its IUPAC name is 3-(1-acetylpiperidin-2-yl)-N-(4-chlorophenyl)piperidine-1-carbothioamide.
| Compound Name | 3-(1-acetylpiperidin-2-yl)-N-(4-chlorophenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 121238333 |
| Molecular Formula | C19H26ClN3OS |
| Molecular Weight | 379.96 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 3-(1-acetylpiperidin-2-yl)-N-(4-chlorophenyl)piperidine-1-carbothioamide |
| SMILES | CC(=O)N1CCCCC1C1CCCN(C(=S)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H26ClN3OS/c1-14(24)23-12-3-2-6-18(23)15-5-4-11-22(13-15)19(25)21-17-9-7-16(20)8-10-17/h7-10,15,18H,2-6,11-13H2,1H3,(H,21,25) |
| InChIKey | GEMPQUZQTAHVDX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.96 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|