C19H30BClN2O4 — CID 66832880
(2S)-2-amino-6-borono-2-[4-[(4-chlorophenyl)methylamino]cyclohexyl]hexanoic acid (PubChem CID 66832880) has the molecular formula C19H30BClN2O4 and a molecular weight of 396.72 g/mol. Its IUPAC name is (2S)-2-amino-6-borono-2-[4-[(4-chlorophenyl)methylamino]cyclohexyl]hexanoic acid.
| Compound Name | (2S)-2-amino-6-borono-2-[4-[(4-chlorophenyl)methylamino]cyclohexyl]hexanoic acid |
|---|---|
| PubChem CID | 66832880 |
| Molecular Formula | C19H30BClN2O4 |
| Molecular Weight | 396.72 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (2S)-2-amino-6-borono-2-[4-[(4-chlorophenyl)methylamino]cyclohexyl]hexanoic acid |
| SMILES | N[C@](CCCCB(O)O)(C(=O)O)C1CCC(NCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H30BClN2O4/c21-16-7-3-14(4-8-16)13-23-17-9-5-15(6-10-17)19(22,18(24)25)11-1-2-12-20(26)27/h3-4,7-8,15,17,23,26-27H,1-2,5-6,9-13,22H2,(H,24,25)/t15?,17?,19-/m0/s1 |
| InChIKey | UEAPRTMJRWMOIU-KVWWFHCMSA-N |
| XLogP | 2.41 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.72 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|