C20H33BF3N3O6S — CID 162576072
2-amino-6-borono-2-[1-[[6-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methylsulfamoyl]piperidin-4-yl]hexanoic acid (PubChem CID 162576072) has the molecular formula C20H33BF3N3O6S and a molecular weight of 511.37 g/mol. Its IUPAC name is 2-amino-6-borono-2-[1-[[6-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methylsulfamoyl]piperidin-4-yl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[1-[[6-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methylsulfamoyl]piperidin-4-yl]hexanoic acid |
|---|---|
| PubChem CID | 162576072 |
| Molecular Formula | C20H33BF3N3O6S |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 2-amino-6-borono-2-[1-[[6-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methylsulfamoyl]piperidin-4-yl]hexanoic acid |
| SMILES | CC1CC(C(F)(F)F)=CC=C1CNS(=O)(=O)N1CCC(C(N)(CCCCB(O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C20H33BF3N3O6S/c1-14-12-17(20(22,23)24)5-4-15(14)13-26-34(32,33)27-10-6-16(7-11-27)19(25,18(28)29)8-2-3-9-21(30)31/h4-5,14,16,26,30-31H,2-3,6-13,25H2,1H3,(H,28,29) |
| InChIKey | RDEFDKNXEJPABX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|