C19H30Cl3NO2 — CID 142749137
2-[4-[(4-chlorophenyl)methylamino]cyclohexyl]hexanoic acid;dihydrochloride (PubChem CID 142749137) has the molecular formula C19H30Cl3NO2 and a molecular weight of 410.81 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)methylamino]cyclohexyl]hexanoic acid;dihydrochloride.
| Compound Name | 2-[4-[(4-chlorophenyl)methylamino]cyclohexyl]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 142749137 |
| Molecular Formula | C19H30Cl3NO2 |
| Molecular Weight | 410.81 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)methylamino]cyclohexyl]hexanoic acid;dihydrochloride |
| SMILES | CCCCC(C(=O)O)C1CCC(NCc2ccc(Cl)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C19H28ClNO2.2ClH/c1-2-3-4-18(19(22)23)15-7-11-17(12-8-15)21-13-14-5-9-16(20)10-6-14;;/h5-6,9-10,15,17-18,21H,2-4,7-8,11-13H2,1H3,(H,22,23);2*1H |
| InChIKey | UJJXAVIHAODBCU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.81 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |