C16H23ClN2O2 — CID 141320364
4-[(4-chlorophenyl)methylamino]-N-methoxy-N-methylcyclohexane-1-carboxamide (PubChem CID 141320364) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methylamino]-N-methoxy-N-methylcyclohexane-1-carboxamide.
| Compound Name | 4-[(4-chlorophenyl)methylamino]-N-methoxy-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 141320364 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-[(4-chlorophenyl)methylamino]-N-methoxy-N-methylcyclohexane-1-carboxamide |
| SMILES | CON(C)C(=O)C1CCC(NCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-19(21-2)16(20)13-5-9-15(10-6-13)18-11-12-3-7-14(17)8-4-12/h3-4,7-8,13,15,18H,5-6,9-11H2,1-2H3 |
| InChIKey | ZPMQYDOWXOHRPE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|