C25H23ClN2O — CID 68819108
N-[4-(4-chlorophenyl)phenyl]-3-[4-[(cyclopropylamino)methyl]phenyl]prop-2-enamide (PubChem CID 68819108) has the molecular formula C25H23ClN2O and a molecular weight of 402.93 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)phenyl]-3-[4-[(cyclopropylamino)methyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-(4-chlorophenyl)phenyl]-3-[4-[(cyclopropylamino)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 68819108 |
| Molecular Formula | C25H23ClN2O |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[4-(4-chlorophenyl)phenyl]-3-[4-[(cyclopropylamino)methyl]phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(CNC2CC2)cc1)Nc1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H23ClN2O/c26-22-10-6-20(7-11-22)21-8-12-24(13-9-21)28-25(29)16-5-18-1-3-19(4-2-18)17-27-23-14-15-23/h1-13,16,23,27H,14-15,17H2,(H,28,29) |
| InChIKey | XRBAKJKGVSDVCO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|