C20H30N2O4 — CID 5016508
benzyl 2-[4-(3-hydroxy-3-methylpentanoyl)-1,4-diazepan-1-yl]acetate (PubChem CID 5016508) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is benzyl 2-[4-(3-hydroxy-3-methylpentanoyl)-1,4-diazepan-1-yl]acetate.
| Compound Name | benzyl 2-[4-(3-hydroxy-3-methylpentanoyl)-1,4-diazepan-1-yl]acetate |
|---|---|
| PubChem CID | 5016508 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | benzyl 2-[4-(3-hydroxy-3-methylpentanoyl)-1,4-diazepan-1-yl]acetate |
| SMILES | CCC(C)(O)CC(=O)N1CCCN(CC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H30N2O4/c1-3-20(2,25)14-18(23)22-11-7-10-21(12-13-22)15-19(24)26-16-17-8-5-4-6-9-17/h4-6,8-9,25H,3,7,10-16H2,1-2H3 |
| InChIKey | ZKCJTIYTCKRJRN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |