C27H30N2O4 — CID 3262319
benzyl 2-[4-(2-ethoxynaphthalene-1-carbonyl)-1,4-diazepan-1-yl]acetate (PubChem CID 3262319) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is benzyl 2-[4-(2-ethoxynaphthalene-1-carbonyl)-1,4-diazepan-1-yl]acetate.
| Compound Name | benzyl 2-[4-(2-ethoxynaphthalene-1-carbonyl)-1,4-diazepan-1-yl]acetate |
|---|---|
| PubChem CID | 3262319 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | benzyl 2-[4-(2-ethoxynaphthalene-1-carbonyl)-1,4-diazepan-1-yl]acetate |
| SMILES | CCOc1ccc2ccccc2c1C(=O)N1CCCN(CC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C27H30N2O4/c1-2-32-24-14-13-22-11-6-7-12-23(22)26(24)27(31)29-16-8-15-28(17-18-29)19-25(30)33-20-21-9-4-3-5-10-21/h3-7,9-14H,2,8,15-20H2,1H3 |
| InChIKey | AOSKTVOWYCZEGU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |