C22H29F3O7 — CID 91201877
4-O-benzyl 1-O-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl] butanedioate;1,1,1-trifluoropropan-2-one (PubChem CID 91201877) has the molecular formula C22H29F3O7 and a molecular weight of 462.46 g/mol. Its IUPAC name is 4-O-benzyl 1-O-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl] butanedioate;1,1,1-trifluoropropan-2-one.
| Compound Name | 4-O-benzyl 1-O-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl] butanedioate;1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 91201877 |
| Molecular Formula | C22H29F3O7 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 4-O-benzyl 1-O-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl] butanedioate;1,1,1-trifluoropropan-2-one |
| SMILES | CC(=O)C(F)(F)F.CC(C)(C)OC(=O)CCCOC(=O)CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H26O6.C3H3F3O/c1-19(2,3)25-18(22)10-7-13-23-16(20)11-12-17(21)24-14-15-8-5-4-6-9-15;1-2(7)3(4,5)6/h4-6,8-9H,7,10-14H2,1-3H3;1H3 |
| InChIKey | ZVVMSDOZOYOOSU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|