C21H22N6O3 — CID 168608486
tert-butyl 4-[2-(1,2,2-tricyanoethenylamino)benzoyl]piperazine-1-carboxylate (PubChem CID 168608486) has the molecular formula C21H22N6O3 and a molecular weight of 406.45 g/mol. Its IUPAC name is tert-butyl 4-[2-(1,2,2-tricyanoethenylamino)benzoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(1,2,2-tricyanoethenylamino)benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168608486 |
| Molecular Formula | C21H22N6O3 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | tert-butyl 4-[2-(1,2,2-tricyanoethenylamino)benzoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2ccccc2NC(C#N)=C(C#N)C#N)CC1 |
| InChI | InChI=1S/C21H22N6O3/c1-21(2,3)30-20(29)27-10-8-26(9-11-27)19(28)16-6-4-5-7-17(16)25-18(14-24)15(12-22)13-23/h4-7,25H,8-11H2,1-3H3 |
| InChIKey | NOSJQLACYGNIFA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 133.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|