C16H23ClN2O3S — CID 143568278
tert-butyl 3-(3-amino-6-chloro-2-hydroxyphenyl)sulfanylpiperidine-1-carboxylate (PubChem CID 143568278) has the molecular formula C16H23ClN2O3S and a molecular weight of 358.89 g/mol. Its IUPAC name is tert-butyl 3-(3-amino-6-chloro-2-hydroxyphenyl)sulfanylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-amino-6-chloro-2-hydroxyphenyl)sulfanylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 143568278 |
| Molecular Formula | C16H23ClN2O3S |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | tert-butyl 3-(3-amino-6-chloro-2-hydroxyphenyl)sulfanylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Sc2c(Cl)ccc(N)c2O)C1 |
| InChI | InChI=1S/C16H23ClN2O3S/c1-16(2,3)22-15(21)19-8-4-5-10(9-19)23-14-11(17)6-7-12(18)13(14)20/h6-7,10,20H,4-5,8-9,18H2,1-3H3 |
| InChIKey | ANPMDZNHDGDINA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|