C16H18ClIN2O3S — CID 143568279
tert-butyl (3R)-3-[(6-chloro-2-iodo-1,3-benzoxazol-7-yl)sulfanyl]pyrrolidine-1-carboxylate (PubChem CID 143568279) has the molecular formula C16H18ClIN2O3S and a molecular weight of 480.76 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(6-chloro-2-iodo-1,3-benzoxazol-7-yl)sulfanyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(6-chloro-2-iodo-1,3-benzoxazol-7-yl)sulfanyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143568279 |
| Molecular Formula | C16H18ClIN2O3S |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 479.98 |
| IUPAC Name | tert-butyl (3R)-3-[(6-chloro-2-iodo-1,3-benzoxazol-7-yl)sulfanyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](Sc2c(Cl)ccc3nc(I)oc23)C1 |
| InChI | InChI=1S/C16H18ClIN2O3S/c1-16(2,3)23-15(21)20-7-6-9(8-20)24-13-10(17)4-5-11-12(13)22-14(18)19-11/h4-5,9H,6-8H2,1-3H3/t9-/m1/s1 |
| InChIKey | ARZNRIZNONODFE-SECBINFHSA-N |
| XLogP | 5.19 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|