C20H25N3O3 — CID 142274095
tert-butyl N-[[4-[[(2-methylpyridine-3-carbonyl)amino]methyl]phenyl]methyl]carbamate (PubChem CID 142274095) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is tert-butyl N-[[4-[[(2-methylpyridine-3-carbonyl)amino]methyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[[(2-methylpyridine-3-carbonyl)amino]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 142274095 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | tert-butyl N-[[4-[[(2-methylpyridine-3-carbonyl)amino]methyl]phenyl]methyl]carbamate |
| SMILES | Cc1ncccc1C(=O)NCc1ccc(CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H25N3O3/c1-14-17(6-5-11-21-14)18(24)22-12-15-7-9-16(10-8-15)13-23-19(25)26-20(2,3)4/h5-11H,12-13H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | OKOQSEGHIBDXQF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |