C35H63N7O7 — CID 123610579
tert-butyl N-butyl-N-[4-[3-[3-[(6-hydrazinylpyridine-3-carbonyl)amino]propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]carbamate (PubChem CID 123610579) has the molecular formula C35H63N7O7 and a molecular weight of 693.93 g/mol. Its IUPAC name is tert-butyl N-butyl-N-[4-[3-[3-[(6-hydrazinylpyridine-3-carbonyl)amino]propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-butyl-N-[4-[3-[3-[(6-hydrazinylpyridine-3-carbonyl)amino]propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 123610579 |
| Molecular Formula | C35H63N7O7 |
| Molecular Weight | 693.93 g/mol |
| Exact Mass | 693.48 |
| IUPAC Name | tert-butyl N-butyl-N-[4-[3-[3-[(6-hydrazinylpyridine-3-carbonyl)amino]propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]carbamate |
| SMILES | CCCCN(CCCCN(CCCN(CCCNC(=O)c1ccc(NN)nc1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H63N7O7/c1-11-12-20-40(30(44)47-33(2,3)4)21-13-14-22-41(31(45)48-34(5,6)7)24-16-25-42(32(46)49-35(8,9)10)23-15-19-37-29(43)27-17-18-28(39-36)38-26-27/h17-18,26H,11-16,19-25,36H2,1-10H3,(H,37,43)(H,38,39) |
| InChIKey | NPOLXDCLKPYWPF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 168.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.93 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|