C18H40N4O7Si3 — CID 158812523
6-hydrazinyl-N,N-bis(3-trimethoxysilylpropyl)pyridine-3-carboxamide;silane (PubChem CID 158812523) has the molecular formula C18H40N4O7Si3 and a molecular weight of 508.80 g/mol. Its IUPAC name is 6-hydrazinyl-N,N-bis(3-trimethoxysilylpropyl)pyridine-3-carboxamide;silane.
| Compound Name | 6-hydrazinyl-N,N-bis(3-trimethoxysilylpropyl)pyridine-3-carboxamide;silane |
|---|---|
| PubChem CID | 158812523 |
| Molecular Formula | C18H40N4O7Si3 |
| Molecular Weight | 508.80 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 6-hydrazinyl-N,N-bis(3-trimethoxysilylpropyl)pyridine-3-carboxamide;silane |
| SMILES | CO[Si](CCCN(CCC[Si](OC)(OC)OC)C(=O)c1ccc(NN)nc1)(OC)OC.[SiH4] |
| InChI | InChI=1S/C18H36N4O7Si2.H4Si/c1-24-30(25-2,26-3)13-7-11-22(12-8-14-31(27-4,28-5)29-6)18(23)16-9-10-17(21-19)20-15-16;/h9-10,15H,7-8,11-14,19H2,1-6H3,(H,20,21);1H4 |
| InChIKey | IUWDMOSVFJIOBQ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.80 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|