C41H50N6O7 — CID 159377649
benzyl 5-[4-[3-[(6-hydrazinylpyridine-3-carbonyl)amino]propyl-phenylmethoxycarbonylamino]butyl-phenylmethoxycarbonylamino]pentanoate (PubChem CID 159377649) has the molecular formula C41H50N6O7 and a molecular weight of 738.89 g/mol. Its IUPAC name is benzyl 5-[4-[3-[(6-hydrazinylpyridine-3-carbonyl)amino]propyl-phenylmethoxycarbonylamino]butyl-phenylmethoxycarbonylamino]pentanoate.
| Compound Name | benzyl 5-[4-[3-[(6-hydrazinylpyridine-3-carbonyl)amino]propyl-phenylmethoxycarbonylamino]butyl-phenylmethoxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 159377649 |
| Molecular Formula | C41H50N6O7 |
| Molecular Weight | 738.89 g/mol |
| Exact Mass | 738.37 |
| IUPAC Name | benzyl 5-[4-[3-[(6-hydrazinylpyridine-3-carbonyl)amino]propyl-phenylmethoxycarbonylamino]butyl-phenylmethoxycarbonylamino]pentanoate |
| SMILES | NNc1ccc(C(=O)NCCCN(CCCCN(CCCCC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cn1 |
| InChI | InChI=1S/C41H50N6O7/c42-45-37-23-22-36(29-44-37)39(49)43-24-14-28-47(41(51)54-32-35-19-8-3-9-20-35)27-13-12-26-46(40(50)53-31-34-17-6-2-7-18-34)25-11-10-21-38(48)52-30-33-15-4-1-5-16-33/h1-9,15-20,22-23,29H,10-14,21,24-28,30-32,42H2,(H,43,49)(H,44,45) |
| InChIKey | LKNDAJYXRBSVSY-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 165.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.89 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|