C31H39N3O12 — CID 159896930
acetyloxymethyl 4-[2-[2-(acetyloxymethoxycarbonylamino)ethyl-phenylmethoxycarbonylamino]ethyl-phenylmethoxycarbonylamino]butanoate (PubChem CID 159896930) has the molecular formula C31H39N3O12 and a molecular weight of 645.66 g/mol. Its IUPAC name is acetyloxymethyl 4-[2-[2-(acetyloxymethoxycarbonylamino)ethyl-phenylmethoxycarbonylamino]ethyl-phenylmethoxycarbonylamino]butanoate.
| Compound Name | acetyloxymethyl 4-[2-[2-(acetyloxymethoxycarbonylamino)ethyl-phenylmethoxycarbonylamino]ethyl-phenylmethoxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 159896930 |
| Molecular Formula | C31H39N3O12 |
| Molecular Weight | 645.66 g/mol |
| Exact Mass | 645.25 |
| IUPAC Name | acetyloxymethyl 4-[2-[2-(acetyloxymethoxycarbonylamino)ethyl-phenylmethoxycarbonylamino]ethyl-phenylmethoxycarbonylamino]butanoate |
| SMILES | CC(=O)OCOC(=O)CCCN(CCN(CCNC(=O)OCOC(C)=O)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H39N3O12/c1-24(35)43-22-45-28(37)14-9-16-33(30(39)41-20-26-10-5-3-6-11-26)18-19-34(17-15-32-29(38)46-23-44-25(2)36)31(40)42-21-27-12-7-4-8-13-27/h3-8,10-13H,9,14-23H2,1-2H3,(H,32,38) |
| InChIKey | SZSWPZKUGYEZIM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 176.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.66 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|