C22H16Cl4NOP — CID 39921399
3,4-dichloro-N-[[(Z)-2-chloro-2-phenylethenyl]-[(E)-2-chloro-2-phenylethenyl]phosphoryl]aniline (PubChem CID 39921399) has the molecular formula C22H16Cl4NOP and a molecular weight of 483.16 g/mol. Its IUPAC name is 3,4-dichloro-N-[[(Z)-2-chloro-2-phenylethenyl]-[(E)-2-chloro-2-phenylethenyl]phosphoryl]aniline.
| Compound Name | 3,4-dichloro-N-[[(Z)-2-chloro-2-phenylethenyl]-[(E)-2-chloro-2-phenylethenyl]phosphoryl]aniline |
|---|---|
| PubChem CID | 39921399 |
| Molecular Formula | C22H16Cl4NOP |
| Molecular Weight | 483.16 g/mol |
| Exact Mass | 480.97 |
| IUPAC Name | 3,4-dichloro-N-[[(Z)-2-chloro-2-phenylethenyl]-[(E)-2-chloro-2-phenylethenyl]phosphoryl]aniline |
| SMILES | O=P(/C=C(\Cl)c1ccccc1)(/C=C(/Cl)c1ccccc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H16Cl4NOP/c23-19-12-11-18(13-20(19)24)27-29(28,14-21(25)16-7-3-1-4-8-16)15-22(26)17-9-5-2-6-10-17/h1-15H,(H,27,28)/b21-14-,22-15+ |
| InChIKey | WDIPRPHUAKTYOI-BILXGNRESA-N |
| XLogP | 9.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.16 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|