C18H14Cl2N3OPS — CID 6032031
N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-1,3,4-thiadiazol-2-amine (PubChem CID 6032031) has the molecular formula C18H14Cl2N3OPS and a molecular weight of 422.28 g/mol. Its IUPAC name is N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 6032031 |
| Molecular Formula | C18H14Cl2N3OPS |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-1,3,4-thiadiazol-2-amine |
| SMILES | O=P(/C=C(\Cl)c1ccccc1)(/C=C(\Cl)c1ccccc1)Nc1nncs1 |
| InChI | InChI=1S/C18H14Cl2N3OPS/c19-16(14-7-3-1-4-8-14)11-25(24,23-18-22-21-13-26-18)12-17(20)15-9-5-2-6-10-15/h1-13H,(H,22,23,24)/b16-11-,17-12- |
| InChIKey | KKPNQWQOAYEJMX-LSQIQBGYSA-N |
| XLogP | 6.70 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|