C22H17Cl3NOP — CID 6257382
N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2-chloroaniline (PubChem CID 6257382) has the molecular formula C22H17Cl3NOP and a molecular weight of 448.72 g/mol. Its IUPAC name is N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2-chloroaniline.
| Compound Name | N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2-chloroaniline |
|---|---|
| PubChem CID | 6257382 |
| Molecular Formula | C22H17Cl3NOP |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 447.01 |
| IUPAC Name | N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2-chloroaniline |
| SMILES | O=P(/C=C(\Cl)c1ccccc1)(/C=C(\Cl)c1ccccc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C22H17Cl3NOP/c23-19-13-7-8-14-22(19)26-28(27,15-20(24)17-9-3-1-4-10-17)16-21(25)18-11-5-2-6-12-18/h1-16H,(H,26,27)/b20-15-,21-16- |
| InChIKey | OYZCFUUMFNOFKS-DRXLFAFDSA-N |
| XLogP | 8.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|