C21H22Cl2NOP — CID 3666298
1-bis(2-chloro-2-phenylethenyl)phosphorylpiperidine (PubChem CID 3666298) has the molecular formula C21H22Cl2NOP and a molecular weight of 406.29 g/mol. Its IUPAC name is 1-bis(2-chloro-2-phenylethenyl)phosphorylpiperidine.
| Compound Name | 1-bis(2-chloro-2-phenylethenyl)phosphorylpiperidine |
|---|---|
| PubChem CID | 3666298 |
| Molecular Formula | C21H22Cl2NOP |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 1-bis(2-chloro-2-phenylethenyl)phosphorylpiperidine |
| SMILES | O=P(C=C(Cl)c1ccccc1)(C=C(Cl)c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C21H22Cl2NOP/c22-20(18-10-4-1-5-11-18)16-26(25,24-14-8-3-9-15-24)17-21(23)19-12-6-2-7-13-19/h1-2,4-7,10-13,16-17H,3,8-9,14-15H2 |
| InChIKey | DHNBQLHMDIITOY-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|