C23H27Cl2N2O2P — CID 2307349
N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3-morpholin-4-ylpropan-1-amine (PubChem CID 2307349) has the molecular formula C23H27Cl2N2O2P and a molecular weight of 465.36 g/mol. Its IUPAC name is N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3-morpholin-4-ylpropan-1-amine.
| Compound Name | N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3-morpholin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 2307349 |
| Molecular Formula | C23H27Cl2N2O2P |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-3-morpholin-4-ylpropan-1-amine |
| SMILES | O=P(/C=C(\Cl)c1ccccc1)(/C=C(\Cl)c1ccccc1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C23H27Cl2N2O2P/c24-22(20-8-3-1-4-9-20)18-30(28,19-23(25)21-10-5-2-6-11-21)26-12-7-13-27-14-16-29-17-15-27/h1-6,8-11,18-19H,7,12-17H2,(H,26,28)/b22-18-,23-19- |
| InChIKey | QOWMKBMYMQFTQB-RSFSRFMPSA-N |
| XLogP | 6.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|