C24H22Cl2NOP — CID 2307241
N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2-phenylethanamine (PubChem CID 2307241) has the molecular formula C24H22Cl2NOP and a molecular weight of 442.33 g/mol. Its IUPAC name is N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2-phenylethanamine.
| Compound Name | N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2-phenylethanamine |
|---|---|
| PubChem CID | 2307241 |
| Molecular Formula | C24H22Cl2NOP |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2-phenylethanamine |
| SMILES | O=P(/C=C(\Cl)c1ccccc1)(/C=C(\Cl)c1ccccc1)NCCc1ccccc1 |
| InChI | InChI=1S/C24H22Cl2NOP/c25-23(21-12-6-2-7-13-21)18-29(28,19-24(26)22-14-8-3-9-15-22)27-17-16-20-10-4-1-5-11-20/h1-15,18-19H,16-17H2,(H,27,28)/b23-18-,24-19- |
| InChIKey | BIHAPUMWPVXHHS-KVOJEJHXSA-N |
| XLogP | 7.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|