C22H17Cl2FNOP — CID 3661620
N-bis(2-chloro-2-phenylethenyl)phosphoryl-4-fluoroaniline (PubChem CID 3661620) has the molecular formula C22H17Cl2FNOP and a molecular weight of 432.26 g/mol. Its IUPAC name is N-bis(2-chloro-2-phenylethenyl)phosphoryl-4-fluoroaniline.
| Compound Name | N-bis(2-chloro-2-phenylethenyl)phosphoryl-4-fluoroaniline |
|---|---|
| PubChem CID | 3661620 |
| Molecular Formula | C22H17Cl2FNOP |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | N-bis(2-chloro-2-phenylethenyl)phosphoryl-4-fluoroaniline |
| SMILES | O=P(C=C(Cl)c1ccccc1)(C=C(Cl)c1ccccc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H17Cl2FNOP/c23-21(17-7-3-1-4-8-17)15-28(27,26-20-13-11-19(25)12-14-20)16-22(24)18-9-5-2-6-10-18/h1-16H,(H,26,27) |
| InChIKey | KYKVVIFMXYJRNE-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|