C29H24Cl2NO2P — CID 39923516
N-[[(Z)-2-chloro-2-phenylethenyl]-[(E)-2-chloro-2-phenylethenyl]phosphoryl]-4-phenylmethoxyaniline (PubChem CID 39923516) has the molecular formula C29H24Cl2NO2P and a molecular weight of 520.40 g/mol. Its IUPAC name is N-[[(Z)-2-chloro-2-phenylethenyl]-[(E)-2-chloro-2-phenylethenyl]phosphoryl]-4-phenylmethoxyaniline.
| Compound Name | N-[[(Z)-2-chloro-2-phenylethenyl]-[(E)-2-chloro-2-phenylethenyl]phosphoryl]-4-phenylmethoxyaniline |
|---|---|
| PubChem CID | 39923516 |
| Molecular Formula | C29H24Cl2NO2P |
| Molecular Weight | 520.40 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | N-[[(Z)-2-chloro-2-phenylethenyl]-[(E)-2-chloro-2-phenylethenyl]phosphoryl]-4-phenylmethoxyaniline |
| SMILES | O=P(/C=C(\Cl)c1ccccc1)(/C=C(/Cl)c1ccccc1)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H24Cl2NO2P/c30-28(24-12-6-2-7-13-24)21-35(33,22-29(31)25-14-8-3-9-15-25)32-26-16-18-27(19-17-26)34-20-23-10-4-1-5-11-23/h1-19,21-22H,20H2,(H,32,33)/b28-21-,29-22+ |
| InChIKey | VQZBKSXAVPFCBH-FJYRUYPUSA-N |
| XLogP | 9.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.40 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|