C22H19Cl2N2O2PS — CID 5243024
1-[2-[bis(2-chloro-2-phenylethenyl)phosphorylamino]-4-methyl-1,3-thiazol-5-yl]ethanone (PubChem CID 5243024) has the molecular formula C22H19Cl2N2O2PS and a molecular weight of 477.35 g/mol. Its IUPAC name is 1-[2-[bis(2-chloro-2-phenylethenyl)phosphorylamino]-4-methyl-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-[bis(2-chloro-2-phenylethenyl)phosphorylamino]-4-methyl-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 5243024 |
| Molecular Formula | C22H19Cl2N2O2PS |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | 1-[2-[bis(2-chloro-2-phenylethenyl)phosphorylamino]-4-methyl-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1sc(NP(=O)(C=C(Cl)c2ccccc2)C=C(Cl)c2ccccc2)nc1C |
| InChI | InChI=1S/C22H19Cl2N2O2PS/c1-15-21(16(2)27)30-22(25-15)26-29(28,13-19(23)17-9-5-3-6-10-17)14-20(24)18-11-7-4-8-12-18/h3-14H,1-2H3,(H,25,26,28) |
| InChIKey | IMVYCNXZUAXDSQ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|