C25H17Cl4N2OPS — CID 2311143
N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-4-(2,5-dichlorophenyl)-1,3-thiazol-2-amine (PubChem CID 2311143) has the molecular formula C25H17Cl4N2OPS and a molecular weight of 566.28 g/mol. Its IUPAC name is N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-4-(2,5-dichlorophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-4-(2,5-dichlorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2311143 |
| Molecular Formula | C25H17Cl4N2OPS |
| Molecular Weight | 566.28 g/mol |
| Exact Mass | 563.96 |
| IUPAC Name | N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-4-(2,5-dichlorophenyl)-1,3-thiazol-2-amine |
| SMILES | O=P(/C=C(\Cl)c1ccccc1)(/C=C(\Cl)c1ccccc1)Nc1nc(-c2cc(Cl)ccc2Cl)cs1 |
| InChI | InChI=1S/C25H17Cl4N2OPS/c26-19-11-12-21(27)20(13-19)24-16-34-25(30-24)31-33(32,14-22(28)17-7-3-1-4-8-17)15-23(29)18-9-5-2-6-10-18/h1-16H,(H,30,31,32)/b22-14-,23-15- |
| InChIKey | ZKTLYUWWNQVHLM-VMTNTFKOSA-N |
| XLogP | 10.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.28 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|