C23H15Cl3N4O2 — CID 145056380
N-[2-(benzenecarboximidoylamino)-1-(3,4-dichlorophenyl)-2-oxoethyl]-3-chloro-4-cyanobenzamide (PubChem CID 145056380) has the molecular formula C23H15Cl3N4O2 and a molecular weight of 485.76 g/mol. Its IUPAC name is N-[2-(benzenecarboximidoylamino)-1-(3,4-dichlorophenyl)-2-oxoethyl]-3-chloro-4-cyanobenzamide.
| Compound Name | N-[2-(benzenecarboximidoylamino)-1-(3,4-dichlorophenyl)-2-oxoethyl]-3-chloro-4-cyanobenzamide |
|---|---|
| PubChem CID | 145056380 |
| Molecular Formula | C23H15Cl3N4O2 |
| Molecular Weight | 485.76 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | N-[2-(benzenecarboximidoylamino)-1-(3,4-dichlorophenyl)-2-oxoethyl]-3-chloro-4-cyanobenzamide |
| SMILES | [H]/N=C(/NC(=O)C(NC(=O)c1ccc(C#N)c(Cl)c1)c1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C23H15Cl3N4O2/c24-17-9-8-14(10-19(17)26)20(23(32)30-21(28)13-4-2-1-3-5-13)29-22(31)15-6-7-16(12-27)18(25)11-15/h1-11,20H,(H,29,31)(H2,28,30,32) |
| InChIKey | GMQBHLVQUHEAIK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.76 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|