C16H11Cl2N3O2 — CID 56785415
3-N-[cyano-(3,4-dichlorophenyl)methyl]benzene-1,3-dicarboxamide (PubChem CID 56785415) has the molecular formula C16H11Cl2N3O2 and a molecular weight of 348.19 g/mol. Its IUPAC name is 3-N-[cyano-(3,4-dichlorophenyl)methyl]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-[cyano-(3,4-dichlorophenyl)methyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 56785415 |
| Molecular Formula | C16H11Cl2N3O2 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 3-N-[cyano-(3,4-dichlorophenyl)methyl]benzene-1,3-dicarboxamide |
| SMILES | N#CC(NC(=O)c1cccc(C(N)=O)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2N3O2/c17-12-5-4-9(7-13(12)18)14(8-19)21-16(23)11-3-1-2-10(6-11)15(20)22/h1-7,14H,(H2,20,22)(H,21,23) |
| InChIKey | NIPFNMOECIUQDG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |