C12H8Cl2N4O — CID 122135194
N-[cyano-(3,4-dichlorophenyl)methyl]-1H-pyrazole-4-carboxamide (PubChem CID 122135194) has the molecular formula C12H8Cl2N4O and a molecular weight of 295.13 g/mol. Its IUPAC name is N-[cyano-(3,4-dichlorophenyl)methyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[cyano-(3,4-dichlorophenyl)methyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 122135194 |
| Molecular Formula | C12H8Cl2N4O |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | N-[cyano-(3,4-dichlorophenyl)methyl]-1H-pyrazole-4-carboxamide |
| SMILES | N#CC(NC(=O)c1cn[nH]c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H8Cl2N4O/c13-9-2-1-7(3-10(9)14)11(4-15)18-12(19)8-5-16-17-6-8/h1-3,5-6,11H,(H,16,17)(H,18,19) |
| InChIKey | GZXRZKCQBHQIRO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |