C22H17BrClN3O2 — CID 140801881
N-[2-(benzenecarboximidoylamino)-1-(3-bromophenyl)-2-oxoethyl]-3-chlorobenzamide (PubChem CID 140801881) has the molecular formula C22H17BrClN3O2 and a molecular weight of 470.75 g/mol. Its IUPAC name is N-[2-(benzenecarboximidoylamino)-1-(3-bromophenyl)-2-oxoethyl]-3-chlorobenzamide.
| Compound Name | N-[2-(benzenecarboximidoylamino)-1-(3-bromophenyl)-2-oxoethyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 140801881 |
| Molecular Formula | C22H17BrClN3O2 |
| Molecular Weight | 470.75 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | N-[2-(benzenecarboximidoylamino)-1-(3-bromophenyl)-2-oxoethyl]-3-chlorobenzamide |
| SMILES | [H]/N=C(/NC(=O)C(NC(=O)c1cccc(Cl)c1)c1cccc(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C22H17BrClN3O2/c23-17-10-4-8-15(12-17)19(26-21(28)16-9-5-11-18(24)13-16)22(29)27-20(25)14-6-2-1-3-7-14/h1-13,19H,(H,26,28)(H2,25,27,29) |
| InChIKey | RGHCYPIGHBHWGY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.75 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|