C21H25Cl2NO2S — CID 46771366
N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(2,3-dimethylphenoxy)butanamide (PubChem CID 46771366) has the molecular formula C21H25Cl2NO2S and a molecular weight of 426.41 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(2,3-dimethylphenoxy)butanamide.
| Compound Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(2,3-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 46771366 |
| Molecular Formula | C21H25Cl2NO2S |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(2,3-dimethylphenoxy)butanamide |
| SMILES | CCC(Oc1cccc(C)c1C)C(=O)NCCSCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H25Cl2NO2S/c1-4-19(26-20-7-5-6-14(2)15(20)3)21(25)24-10-11-27-13-16-8-9-17(22)18(23)12-16/h5-9,12,19H,4,10-11,13H2,1-3H3,(H,24,25) |
| InChIKey | DZKFKMKQTGNQDO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|