C19H22ClNO3S — CID 9173320
(2S)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(2-methoxyphenoxy)propanamide (PubChem CID 9173320) has the molecular formula C19H22ClNO3S and a molecular weight of 379.91 g/mol. Its IUPAC name is (2S)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(2-methoxyphenoxy)propanamide.
| Compound Name | (2S)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(2-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 9173320 |
| Molecular Formula | C19H22ClNO3S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (2S)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(2-methoxyphenoxy)propanamide |
| SMILES | COc1ccccc1O[C@@H](C)C(=O)NCCSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClNO3S/c1-14(24-18-6-4-3-5-17(18)23-2)19(22)21-11-12-25-13-15-7-9-16(20)10-8-15/h3-10,14H,11-13H2,1-2H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | DWJUOMIPXDMLAY-AWEZNQCLSA-N |
| XLogP | 4.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|