C19H29NO2S — CID 100613828
(2R)-N-(2-cyclopentylsulfanylethyl)-2-(3,5-dimethylphenoxy)butanamide (PubChem CID 100613828) has the molecular formula C19H29NO2S and a molecular weight of 335.51 g/mol. Its IUPAC name is (2R)-N-(2-cyclopentylsulfanylethyl)-2-(3,5-dimethylphenoxy)butanamide.
| Compound Name | (2R)-N-(2-cyclopentylsulfanylethyl)-2-(3,5-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 100613828 |
| Molecular Formula | C19H29NO2S |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (2R)-N-(2-cyclopentylsulfanylethyl)-2-(3,5-dimethylphenoxy)butanamide |
| SMILES | CC[C@@H](Oc1cc(C)cc(C)c1)C(=O)NCCSC1CCCC1 |
| InChI | InChI=1S/C19H29NO2S/c1-4-18(22-16-12-14(2)11-15(3)13-16)19(21)20-9-10-23-17-7-5-6-8-17/h11-13,17-18H,4-10H2,1-3H3,(H,20,21)/t18-/m1/s1 |
| InChIKey | IHTDPOJOZGPMTI-GOSISDBHSA-N |
| XLogP | 4.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|