C24H33NO2 — CID 132655072
2-(3,5-dimethylphenoxy)-N-[3-(4-propan-2-ylphenyl)propyl]butanamide (PubChem CID 132655072) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-[3-(4-propan-2-ylphenyl)propyl]butanamide.
| Compound Name | 2-(3,5-dimethylphenoxy)-N-[3-(4-propan-2-ylphenyl)propyl]butanamide |
|---|---|
| PubChem CID | 132655072 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-[3-(4-propan-2-ylphenyl)propyl]butanamide |
| SMILES | CCC(Oc1cc(C)cc(C)c1)C(=O)NCCCc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C24H33NO2/c1-6-23(27-22-15-18(4)14-19(5)16-22)24(26)25-13-7-8-20-9-11-21(12-10-20)17(2)3/h9-12,14-17,23H,6-8,13H2,1-5H3,(H,25,26) |
| InChIKey | KLAOJRYWDOPUEC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|