C20H25NO2S — CID 43905864
2-(3-methylphenoxy)-N-[2-(4-methylphenyl)sulfanylethyl]butanamide (PubChem CID 43905864) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is 2-(3-methylphenoxy)-N-[2-(4-methylphenyl)sulfanylethyl]butanamide.
| Compound Name | 2-(3-methylphenoxy)-N-[2-(4-methylphenyl)sulfanylethyl]butanamide |
|---|---|
| PubChem CID | 43905864 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-(3-methylphenoxy)-N-[2-(4-methylphenyl)sulfanylethyl]butanamide |
| SMILES | CCC(Oc1cccc(C)c1)C(=O)NCCSc1ccc(C)cc1 |
| InChI | InChI=1S/C20H25NO2S/c1-4-19(23-17-7-5-6-16(3)14-17)20(22)21-12-13-24-18-10-8-15(2)9-11-18/h5-11,14,19H,4,12-13H2,1-3H3,(H,21,22) |
| InChIKey | AOPBWFSFMRSZDF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|