C18H19F3N2O3S — CID 30252886
2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-(4-fluorophenyl)propyl]acetamide (PubChem CID 30252886) has the molecular formula C18H19F3N2O3S and a molecular weight of 400.42 g/mol. Its IUPAC name is 2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-(4-fluorophenyl)propyl]acetamide.
| Compound Name | 2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-(4-fluorophenyl)propyl]acetamide |
|---|---|
| PubChem CID | 30252886 |
| Molecular Formula | C18H19F3N2O3S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-(3,4-difluoro-N-methylsulfonylanilino)-N-[3-(4-fluorophenyl)propyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCCc1ccc(F)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H19F3N2O3S/c1-27(25,26)23(15-8-9-16(20)17(21)11-15)12-18(24)22-10-2-3-13-4-6-14(19)7-5-13/h4-9,11H,2-3,10,12H2,1H3,(H,22,24) |
| InChIKey | FKCQYJFMJGABTF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|