C23H32N2O3S2 — CID 30253980
2-(4-tert-butyl-N-methylsulfonylanilino)-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide (PubChem CID 30253980) has the molecular formula C23H32N2O3S2 and a molecular weight of 448.65 g/mol. Its IUPAC name is 2-(4-tert-butyl-N-methylsulfonylanilino)-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide.
| Compound Name | 2-(4-tert-butyl-N-methylsulfonylanilino)-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide |
|---|---|
| PubChem CID | 30253980 |
| Molecular Formula | C23H32N2O3S2 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-(4-tert-butyl-N-methylsulfonylanilino)-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide |
| SMILES | Cc1ccc(SCCCNC(=O)CN(c2ccc(C(C)(C)C)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H32N2O3S2/c1-18-7-13-21(14-8-18)29-16-6-15-24-22(26)17-25(30(5,27)28)20-11-9-19(10-12-20)23(2,3)4/h7-14H,6,15-17H2,1-5H3,(H,24,26) |
| InChIKey | IVEDFTRBBLMKOH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|