C25H25Cl2N3O5S — CID 2239418
2-[[2-(2,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-(2-methoxyethyl)benzamide (PubChem CID 2239418) has the molecular formula C25H25Cl2N3O5S and a molecular weight of 550.46 g/mol. Its IUPAC name is 2-[[2-(2,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-[[2-(2,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 2239418 |
| Molecular Formula | C25H25Cl2N3O5S |
| Molecular Weight | 550.46 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | 2-[[2-(2,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccccc1NC(=O)CN(c1cc(Cl)ccc1Cl)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H25Cl2N3O5S/c1-17-7-10-19(11-8-17)36(33,34)30(23-15-18(26)9-12-21(23)27)16-24(31)29-22-6-4-3-5-20(22)25(32)28-13-14-35-2/h3-12,15H,13-14,16H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | YKHFJBARPHMSFP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|